C30H39F3N2O6S2Si — CID 102107789
methyl (2S)-3-[4-[(E)-2-(benzenesulfonyl)ethenyl]-1-tri(propan-2-yl)silylindol-3-yl]-2-(trifluoromethylsulfonylamino)propanoate (PubChem CID 102107789) has the molecular formula C30H39F3N2O6S2Si and a molecular weight of 672.86 g/mol. Its IUPAC name is methyl (2S)-3-[4-[(E)-2-(benzenesulfonyl)ethenyl]-1-tri(propan-2-yl)silylindol-3-yl]-2-(trifluoromethylsulfonylamino)propanoate.
| Compound Name | methyl (2S)-3-[4-[(E)-2-(benzenesulfonyl)ethenyl]-1-tri(propan-2-yl)silylindol-3-yl]-2-(trifluoromethylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 102107789 |
| Molecular Formula | C30H39F3N2O6S2Si |
| Molecular Weight | 672.86 g/mol |
| Exact Mass | 672.20 |
| IUPAC Name | methyl (2S)-3-[4-[(E)-2-(benzenesulfonyl)ethenyl]-1-tri(propan-2-yl)silylindol-3-yl]-2-(trifluoromethylsulfonylamino)propanoate |
| SMILES | COC(=O)[C@H](Cc1cn([Si](C(C)C)(C(C)C)C(C)C)c2cccc(/C=C/S(=O)(=O)c3ccccc3)c12)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C30H39F3N2O6S2Si/c1-20(2)44(21(3)4,22(5)6)35-19-24(18-26(29(36)41-7)34-43(39,40)30(31,32)33)28-23(12-11-15-27(28)35)16-17-42(37,38)25-13-9-8-10-14-25/h8-17,19-22,26,34H,18H2,1-7H3/b17-16+/t26-/m0/s1 |
| InChIKey | QVBMPRJCFXXBAI-ZOGILVBSSA-N |
| XLogP | 6.63 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.86 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|