C38H56ClN3O6SSi2 — CID 171478453
methyl (2S)-3-[6-chloro-1-tri(propan-2-yl)silyl-4-[2-tri(propan-2-yl)silylethynyl]indol-3-yl]-2-[(4-nitrophenyl)sulfonylamino]propanoate (PubChem CID 171478453) has the molecular formula C38H56ClN3O6SSi2 and a molecular weight of 774.57 g/mol. Its IUPAC name is methyl (2S)-3-[6-chloro-1-tri(propan-2-yl)silyl-4-[2-tri(propan-2-yl)silylethynyl]indol-3-yl]-2-[(4-nitrophenyl)sulfonylamino]propanoate.
| Compound Name | methyl (2S)-3-[6-chloro-1-tri(propan-2-yl)silyl-4-[2-tri(propan-2-yl)silylethynyl]indol-3-yl]-2-[(4-nitrophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 171478453 |
| Molecular Formula | C38H56ClN3O6SSi2 |
| Molecular Weight | 774.57 g/mol |
| Exact Mass | 773.31 |
| IUPAC Name | methyl (2S)-3-[6-chloro-1-tri(propan-2-yl)silyl-4-[2-tri(propan-2-yl)silylethynyl]indol-3-yl]-2-[(4-nitrophenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)[C@H](Cc1cn([Si](C(C)C)(C(C)C)C(C)C)c2cc(Cl)cc(C#C[Si](C(C)C)(C(C)C)C(C)C)c12)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C38H56ClN3O6SSi2/c1-24(2)50(25(3)4,26(5)6)19-18-30-20-32(39)22-36-37(30)31(23-41(36)51(27(7)8,28(9)10)29(11)12)21-35(38(43)48-13)40-49(46,47)34-16-14-33(15-17-34)42(44)45/h14-17,20,22-29,35,40H,21H2,1-13H3/t35-/m0/s1 |
| InChIKey | KIANJUYSQRYAIE-DHUJRADRSA-N |
| XLogP | 9.86 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.57 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|