C22H33F3N2O5SSi — CID 162419351
methyl (2S)-3-[4-hydroxy-1-tri(propan-2-yl)silylindol-3-yl]-2-(trifluoromethylsulfonylamino)propanoate (PubChem CID 162419351) has the molecular formula C22H33F3N2O5SSi and a molecular weight of 522.66 g/mol. Its IUPAC name is methyl (2S)-3-[4-hydroxy-1-tri(propan-2-yl)silylindol-3-yl]-2-(trifluoromethylsulfonylamino)propanoate.
| Compound Name | methyl (2S)-3-[4-hydroxy-1-tri(propan-2-yl)silylindol-3-yl]-2-(trifluoromethylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 162419351 |
| Molecular Formula | C22H33F3N2O5SSi |
| Molecular Weight | 522.66 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | methyl (2S)-3-[4-hydroxy-1-tri(propan-2-yl)silylindol-3-yl]-2-(trifluoromethylsulfonylamino)propanoate |
| SMILES | COC(=O)[C@H](Cc1cn([Si](C(C)C)(C(C)C)C(C)C)c2cccc(O)c12)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C22H33F3N2O5SSi/c1-13(2)34(14(3)4,15(5)6)27-12-16(20-18(27)9-8-10-19(20)28)11-17(21(29)32-7)26-33(30,31)22(23,24)25/h8-10,12-15,17,26,28H,11H2,1-7H3/t17-/m0/s1 |
| InChIKey | ZYWWFDIZORLSIZ-KRWDZBQOSA-N |
| XLogP | 4.89 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.66 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|