C36H50F3N3O7SSi — CID 162419348
benzyl (3S)-2-[[(2S)-3-[4-acetyloxy-1-tri(propan-2-yl)silylindol-3-yl]-2-(trifluoromethylsulfonylamino)propanoyl]amino]-3-methylpentanoate (PubChem CID 162419348) has the molecular formula C36H50F3N3O7SSi and a molecular weight of 753.96 g/mol. Its IUPAC name is benzyl (3S)-2-[[(2S)-3-[4-acetyloxy-1-tri(propan-2-yl)silylindol-3-yl]-2-(trifluoromethylsulfonylamino)propanoyl]amino]-3-methylpentanoate.
| Compound Name | benzyl (3S)-2-[[(2S)-3-[4-acetyloxy-1-tri(propan-2-yl)silylindol-3-yl]-2-(trifluoromethylsulfonylamino)propanoyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 162419348 |
| Molecular Formula | C36H50F3N3O7SSi |
| Molecular Weight | 753.96 g/mol |
| Exact Mass | 753.31 |
| IUPAC Name | benzyl (3S)-2-[[(2S)-3-[4-acetyloxy-1-tri(propan-2-yl)silylindol-3-yl]-2-(trifluoromethylsulfonylamino)propanoyl]amino]-3-methylpentanoate |
| SMILES | CC[C@H](C)C(NC(=O)[C@H](Cc1cn([Si](C(C)C)(C(C)C)C(C)C)c2cccc(OC(C)=O)c12)NS(=O)(=O)C(F)(F)F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H50F3N3O7SSi/c1-10-25(8)33(35(45)48-21-27-15-12-11-13-16-27)40-34(44)29(41-50(46,47)36(37,38)39)19-28-20-42(51(22(2)3,23(4)5)24(6)7)30-17-14-18-31(32(28)30)49-26(9)43/h11-18,20,22-25,29,33,41H,10,19,21H2,1-9H3,(H,40,44)/t25-,29-,33?/m0/s1 |
| InChIKey | VUUWZDNAZMJULT-BOQWNVBCSA-N |
| XLogP | 7.21 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.96 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|