C22H19ClN4O5 — CID 71515123
5-[[4-[1-(2-chloropyridine-3-carbonyl)piperidin-4-yl]oxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 71515123) has the molecular formula C22H19ClN4O5 and a molecular weight of 454.87 g/mol. Its IUPAC name is 5-[[4-[1-(2-chloropyridine-3-carbonyl)piperidin-4-yl]oxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[4-[1-(2-chloropyridine-3-carbonyl)piperidin-4-yl]oxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 71515123 |
| Molecular Formula | C22H19ClN4O5 |
| Molecular Weight | 454.87 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 5-[[4-[1-(2-chloropyridine-3-carbonyl)piperidin-4-yl]oxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=Cc2ccc(OC3CCN(C(=O)c4cccnc4Cl)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C22H19ClN4O5/c23-18-16(2-1-9-24-18)21(30)27-10-7-15(8-11-27)32-14-5-3-13(4-6-14)12-17-19(28)25-22(31)26-20(17)29/h1-6,9,12,15H,7-8,10-11H2,(H2,25,26,28,29,31) |
| InChIKey | KPHSYIFTHASGPO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.87 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|