C19H21NO3 — CID 71519741
4-(1,3-benzodioxol-4-ylmethylideneamino)-2-tert-butyl-5-methylphenol (PubChem CID 71519741) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-4-ylmethylideneamino)-2-tert-butyl-5-methylphenol.
| Compound Name | 4-(1,3-benzodioxol-4-ylmethylideneamino)-2-tert-butyl-5-methylphenol |
|---|---|
| PubChem CID | 71519741 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 4-(1,3-benzodioxol-4-ylmethylideneamino)-2-tert-butyl-5-methylphenol |
| SMILES | Cc1cc(O)c(C(C)(C)C)cc1/N=C/c1cccc2c1OCO2 |
| InChI | InChI=1S/C19H21NO3/c1-12-8-16(21)14(19(2,3)4)9-15(12)20-10-13-6-5-7-17-18(13)23-11-22-17/h5-10,21H,11H2,1-4H3/b20-10+ |
| InChIKey | BZJSWBHCUDNXOM-KEBDBYFISA-N |
| XLogP | 4.48 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|