C22H27NO6 — CID 71540032
ethyl (1R,10S,11S)-4-ethoxycarbonyloxy-8-oxo-12-azatetracyclo[9.3.3.01,10.02,7]heptadeca-2(7),3,5-triene-12-carboxylate (PubChem CID 71540032) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is ethyl (1R,10S,11S)-4-ethoxycarbonyloxy-8-oxo-12-azatetracyclo[9.3.3.01,10.02,7]heptadeca-2(7),3,5-triene-12-carboxylate.
| Compound Name | ethyl (1R,10S,11S)-4-ethoxycarbonyloxy-8-oxo-12-azatetracyclo[9.3.3.01,10.02,7]heptadeca-2(7),3,5-triene-12-carboxylate |
|---|---|
| PubChem CID | 71540032 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | ethyl (1R,10S,11S)-4-ethoxycarbonyloxy-8-oxo-12-azatetracyclo[9.3.3.01,10.02,7]heptadeca-2(7),3,5-triene-12-carboxylate |
| SMILES | CCOC(=O)Oc1ccc2c(c1)[C@@]13CCC[C@@H]([C@H]1CC2=O)N(C(=O)OCC)CC3 |
| InChI | InChI=1S/C22H27NO6/c1-3-27-20(25)23-11-10-22-9-5-6-18(23)17(22)13-19(24)15-8-7-14(12-16(15)22)29-21(26)28-4-2/h7-8,12,17-18H,3-6,9-11,13H2,1-2H3/t17-,18+,22+/m1/s1 |
| InChIKey | SFWZNCNGRLCKCF-FGSXEWAUSA-N |
| XLogP | 4.08 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|