C25H36NO6+ — CID 155649486
[(1S,9S,10S)-17-(1-ethoxycarbonyloxyethyl)-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] ethyl carbonate (PubChem CID 155649486) has the molecular formula C25H36NO6+ and a molecular weight of 446.56 g/mol. Its IUPAC name is [(1S,9S,10S)-17-(1-ethoxycarbonyloxyethyl)-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] ethyl carbonate.
| Compound Name | [(1S,9S,10S)-17-(1-ethoxycarbonyloxyethyl)-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] ethyl carbonate |
|---|---|
| PubChem CID | 155649486 |
| Molecular Formula | C25H36NO6+ |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | [(1S,9S,10S)-17-(1-ethoxycarbonyloxyethyl)-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc2c(c1)[C@]13CCCC[C@@H]1[C@H](C2)[N+](C)(C(C)OC(=O)OCC)CC3 |
| InChI | InChI=1S/C25H36NO6/c1-5-29-23(27)31-17(3)26(4)14-13-25-12-8-7-9-20(25)22(26)15-18-10-11-19(16-21(18)25)32-24(28)30-6-2/h10-11,16-17,20,22H,5-9,12-15H2,1-4H3/q+1/t17?,20-,22+,25+,26?/m1/s1 |
| InChIKey | CTFZREWKETYDNW-KQEZNFQJSA-N |
| XLogP | 4.94 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|