C25H37NO6 — CID 142456728
1-[[(4bS)-3-ethoxycarbonyloxy-4b-ethyl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-yl]-methylamino]ethyl ethyl carbonate (PubChem CID 142456728) has the molecular formula C25H37NO6 and a molecular weight of 447.57 g/mol. Its IUPAC name is 1-[[(4bS)-3-ethoxycarbonyloxy-4b-ethyl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-yl]-methylamino]ethyl ethyl carbonate.
| Compound Name | 1-[[(4bS)-3-ethoxycarbonyloxy-4b-ethyl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-yl]-methylamino]ethyl ethyl carbonate |
|---|---|
| PubChem CID | 142456728 |
| Molecular Formula | C25H37NO6 |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | 1-[[(4bS)-3-ethoxycarbonyloxy-4b-ethyl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-yl]-methylamino]ethyl ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc2c(c1)[C@@]1(CC)CCCCC1C(N(C)C(C)OC(=O)OCC)C2 |
| InChI | InChI=1S/C25H37NO6/c1-6-25-14-10-9-11-20(25)22(26(5)17(4)31-23(27)29-7-2)15-18-12-13-19(16-21(18)25)32-24(28)30-8-3/h12-13,16-17,20,22H,6-11,14-15H2,1-5H3/t17?,20?,22?,25-/m0/s1 |
| InChIKey | XFTBDALUWXZGCB-WBAHGDOWSA-N |
| XLogP | 5.44 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|