C22H37NO — CID 169208814
4b-ethyl-3-methoxy-N,N,2-trimethyl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-amine;ethane (PubChem CID 169208814) has the molecular formula C22H37NO and a molecular weight of 331.54 g/mol. Its IUPAC name is 4b-ethyl-3-methoxy-N,N,2-trimethyl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-amine;ethane.
| Compound Name | 4b-ethyl-3-methoxy-N,N,2-trimethyl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-amine;ethane |
|---|---|
| PubChem CID | 169208814 |
| Molecular Formula | C22H37NO |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.29 |
| IUPAC Name | 4b-ethyl-3-methoxy-N,N,2-trimethyl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-amine;ethane |
| SMILES | CC.CCC12CCCCC1C(N(C)C)Cc1cc(C)c(OC)cc12 |
| InChI | InChI=1S/C20H31NO.C2H6/c1-6-20-10-8-7-9-16(20)18(21(3)4)12-15-11-14(2)19(22-5)13-17(15)20;1-2/h11,13,16,18H,6-10,12H2,1-5H3;1-2H3 |
| InChIKey | LBQZKEOHDPZRJR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |