C26H40NO6+ — CID 142456733
1-[(1R)-4-ethoxycarbonyloxy-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]ethyl formate;methoxyethane (PubChem CID 142456733) has the molecular formula C26H40NO6+ and a molecular weight of 462.61 g/mol. Its IUPAC name is 1-[(1R)-4-ethoxycarbonyloxy-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]ethyl formate;methoxyethane.
| Compound Name | 1-[(1R)-4-ethoxycarbonyloxy-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]ethyl formate;methoxyethane |
|---|---|
| PubChem CID | 142456733 |
| Molecular Formula | C26H40NO6+ |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | 1-[(1R)-4-ethoxycarbonyloxy-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]ethyl formate;methoxyethane |
| SMILES | CCOC.CCOC(=O)Oc1ccc2c(c1)[C@@]13CCCCC1C(C2)[N+](C)(C(C)OC=O)CC3 |
| InChI | InChI=1S/C23H32NO5.C3H8O/c1-4-27-22(26)29-18-9-8-17-13-21-19-7-5-6-10-23(19,20(17)14-18)11-12-24(21,3)16(2)28-15-25;1-3-4-2/h8-9,14-16,19,21H,4-7,10-13H2,1-3H3;3H2,1-2H3/q+1;/t16?,19?,21?,23-,24?;/m1./s1 |
| InChIKey | LJCZVZKIMYNEIH-HLZLPLIYSA-N |
| XLogP | 4.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|