C17H20N4O2S — CID 71552853
1-[(E)-[(3,4-dimethoxyphenyl)-(6-methyl-2-pyridinyl)methylidene]amino]-3-methylthiourea (PubChem CID 71552853) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 1-[(E)-[(3,4-dimethoxyphenyl)-(6-methyl-2-pyridinyl)methylidene]amino]-3-methylthiourea.
| Compound Name | 1-[(E)-[(3,4-dimethoxyphenyl)-(6-methyl-2-pyridinyl)methylidene]amino]-3-methylthiourea |
|---|---|
| PubChem CID | 71552853 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-[(E)-[(3,4-dimethoxyphenyl)-(6-methyl-2-pyridinyl)methylidene]amino]-3-methylthiourea |
| SMILES | CNC(=S)N/N=C(\c1ccc(OC)c(OC)c1)c1cccc(C)n1 |
| InChI | InChI=1S/C17H20N4O2S/c1-11-6-5-7-13(19-11)16(20-21-17(24)18-2)12-8-9-14(22-3)15(10-12)23-4/h5-10H,1-4H3,(H2,18,21,24)/b20-16+ |
| InChIKey | RYNRGNFTUYUNRA-CAPFRKAQSA-N |
| XLogP | 2.25 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|