C28H23Cl2F2N3O7 — CID 71554258
[(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 2-(2,4-dioxo-1H-quinazolin-3-yl)acetate (PubChem CID 71554258) has the molecular formula C28H23Cl2F2N3O7 and a molecular weight of 622.41 g/mol. Its IUPAC name is [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 2-(2,4-dioxo-1H-quinazolin-3-yl)acetate.
| Compound Name | [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 2-(2,4-dioxo-1H-quinazolin-3-yl)acetate |
|---|---|
| PubChem CID | 71554258 |
| Molecular Formula | C28H23Cl2F2N3O7 |
| Molecular Weight | 622.41 g/mol |
| Exact Mass | 621.09 |
| IUPAC Name | [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 2-(2,4-dioxo-1H-quinazolin-3-yl)acetate |
| SMILES | O=C(Cn1c(=O)[nH]c2ccccc2c1=O)O[C@@H](Cc1c(Cl)c[n+]([O-])cc1Cl)c1ccc(OC(F)F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C28H23Cl2F2N3O7/c29-19-11-34(39)12-20(30)18(19)10-23(16-7-8-22(42-27(31)32)24(9-16)40-14-15-5-6-15)41-25(36)13-35-26(37)17-3-1-2-4-21(17)33-28(35)38/h1-4,7-9,11-12,15,23,27H,5-6,10,13-14H2,(H,33,38)/t23-/m0/s1 |
| InChIKey | XTRIDGTXZBDSFL-QHCPKHFHSA-N |
| XLogP | 4.55 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|