C32H48BN2O5S — CID 71557379
CID 71557379 (PubChem CID 71557379) has the molecular formula C32H48BN2O5S and a molecular weight of 583.62 g/mol.
| Compound Name | CID 71557379 |
|---|---|
| PubChem CID | 71557379 |
| Molecular Formula | C32H48BN2O5S |
| Molecular Weight | 583.62 g/mol |
| Exact Mass | 583.34 |
| IUPAC Name | — |
| SMILES | CN([C]1[CH][CH][C](CNC(=O)CCCCCCCCCCS)[CH]1)C(=O)OCc1ccccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C32H48BN2O5S/c1-31(2)32(3,4)40-33(39-31)28-17-14-13-16-26(28)24-38-30(37)35(5)27-20-19-25(22-27)23-34-29(36)18-12-10-8-6-7-9-11-15-21-41/h13-14,16-17,19-20,22,41H,6-12,15,18,21,23-24H2,1-5H3,(H,34,36) |
| InChIKey | KMKAXPICPKPMFC-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.62 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|