C41H65BN3O14S — CID 71557698
CID 71557698 (PubChem CID 71557698) has the molecular formula C41H65BN3O14S and a molecular weight of 866.86 g/mol.
| Compound Name | CID 71557698 |
|---|---|
| PubChem CID | 71557698 |
| Molecular Formula | C41H65BN3O14S |
| Molecular Weight | 866.86 g/mol |
| Exact Mass | 866.43 |
| IUPAC Name | — |
| SMILES | CC1(C)OB(c2cccc(COC(=O)N[C]3[CH][CH][C](CNC(=O)CNC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCS)[CH]3)c2)OC1(C)C |
| InChI | InChI=1S/C41H65BN3O14S/c1-40(2)41(3,4)59-42(58-40)35-7-5-6-34(28-35)32-57-39(48)45-36-9-8-33(29-36)30-43-38(47)31-44-37(46)10-11-49-12-13-50-14-15-51-16-17-52-18-19-53-20-21-54-22-23-55-24-25-56-26-27-60/h5-9,28-29,60H,10-27,30-32H2,1-4H3,(H,43,47)(H,44,46)(H,45,48) |
| InChIKey | BLBBIVRBIVQESV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 188.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.86 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|