C19H38O2Si2 — CID 71559952
[(1S,4aR,6S,8aS)-1,6-dimethyl-2-trimethylsilyloxy-4a,5,6,7,8,8a-hexahydro-4H-naphthalen-1-yl]methoxy-trimethylsilane (PubChem CID 71559952) has the molecular formula C19H38O2Si2 and a molecular weight of 354.68 g/mol. Its IUPAC name is [(1S,4aR,6S,8aS)-1,6-dimethyl-2-trimethylsilyloxy-4a,5,6,7,8,8a-hexahydro-4H-naphthalen-1-yl]methoxy-trimethylsilane.
| Compound Name | [(1S,4aR,6S,8aS)-1,6-dimethyl-2-trimethylsilyloxy-4a,5,6,7,8,8a-hexahydro-4H-naphthalen-1-yl]methoxy-trimethylsilane |
|---|---|
| PubChem CID | 71559952 |
| Molecular Formula | C19H38O2Si2 |
| Molecular Weight | 354.68 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | [(1S,4aR,6S,8aS)-1,6-dimethyl-2-trimethylsilyloxy-4a,5,6,7,8,8a-hexahydro-4H-naphthalen-1-yl]methoxy-trimethylsilane |
| SMILES | C[C@H]1CC[C@H]2[C@@H](CC=C(O[Si](C)(C)C)[C@]2(C)CO[Si](C)(C)C)C1 |
| InChI | InChI=1S/C19H38O2Si2/c1-15-9-11-17-16(13-15)10-12-18(21-23(6,7)8)19(17,2)14-20-22(3,4)5/h12,15-17H,9-11,13-14H2,1-8H3/t15-,16-,17-,19+/m0/s1 |
| InChIKey | SAAWXDCAHIJQRZ-LSTDLKDCSA-N |
| XLogP | 6.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.68 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|