C18H11N3O4S2 — CID 71570660
2-(2-oxochromen-3-yl)imidazo[2,1-b][1,3]benzothiazole-6-sulfonamide (PubChem CID 71570660) has the molecular formula C18H11N3O4S2 and a molecular weight of 397.44 g/mol. Its IUPAC name is 2-(2-oxochromen-3-yl)imidazo[2,1-b][1,3]benzothiazole-6-sulfonamide.
| Compound Name | 2-(2-oxochromen-3-yl)imidazo[2,1-b][1,3]benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 71570660 |
| Molecular Formula | C18H11N3O4S2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 2-(2-oxochromen-3-yl)imidazo[2,1-b][1,3]benzothiazole-6-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)sc1nc(-c3cc4ccccc4oc3=O)cn12 |
| InChI | InChI=1S/C18H11N3O4S2/c19-27(23,24)11-5-6-14-16(8-11)26-18-20-13(9-21(14)18)12-7-10-3-1-2-4-15(10)25-17(12)22/h1-9H,(H2,19,23,24) |
| InChIKey | BIBMGOMAPOAXCH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 107.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|