About 2-(2-oxochromen-3-yl)imidazo[2,1-b][1,3]benzothiazole-6-sulfonamide
2-(2-oxochromen-3-yl)imidazo[2,1-b][1,3]benzothiazole-6-sulfonamide (PubChem CID 71570660) has the molecular formula C18H11N3O4S2
and a molecular weight of 397.44 g/mol. Its IUPAC name is 2-(2-oxochromen-3-yl)imidazo[2,1-b][1,3]benzothiazole-6-sulfonamide.
Molecular Properties
| Compound Name | 2-(2-oxochromen-3-yl)imidazo[2,1-b][1,3]benzothiazole-6-sulfonamide |
| PubChem CID | 71570660 |
| Molecular Formula | C18H11N3O4S2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 2-(2-oxochromen-3-yl)imidazo[2,1-b][1,3]benzothiazole-6-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)sc1nc(-c3cc4ccccc4oc3=O)cn12 |
| InChI | InChI=1S/C18H11N3O4S2/c19-27(23,24)11-5-6-14-16(8-11)26-18-20-13(9-21(14)18)12-7-10-3-1-2-4-15(10)25-17(12)22/h1-9H,(H2,19,23,24) |
| InChIKey | BIBMGOMAPOAXCH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 107.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-oxochromen-3-yl)imidazo[2,1-b][1,3]benzothiazole-6-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-oxochromen-3-yl)imidazo[2,1-b][1,3]benzothiazole-6-sulfonamide?
The IUPAC name of 2-(2-oxochromen-3-yl)imidazo[2,1-b][1,3]benzothiazole-6-sulfonamide (CID 71570660) is 2-(2-oxochromen-3-yl)imidazo[2,1-b][1,3]benzothiazole-6-sulfonamide.
What is the SMILES notation for 2-(2-oxochromen-3-yl)imidazo[2,1-b][1,3]benzothiazole-6-sulfonamide?
The canonical SMILES for 2-(2-oxochromen-3-yl)imidazo[2,1-b][1,3]benzothiazole-6-sulfonamide is NS(=O)(=O)c1ccc2c(c1)sc1nc(-c3cc4ccccc4oc3=O)cn12.
What is the InChIKey of 2-(2-oxochromen-3-yl)imidazo[2,1-b][1,3]benzothiazole-6-sulfonamide?
The InChIKey is BIBMGOMAPOAXCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11N3O4S2/c19-27(23,24)11-5-6-14-16(8-11)26-18-20-13(9-21(14)18)12-7-10-3-1-2-4-15(10)25-17(12)22/h1-9H,(H2,19,23,24).
What are the key properties of 2-(2-oxochromen-3-yl)imidazo[2,1-b][1,3]benzothiazole-6-sulfonamide?
2-(2-oxochromen-3-yl)imidazo[2,1-b][1,3]benzothiazole-6-sulfonamide has a molecular weight of 397.44 g/mol, XLogP of 2.97, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxochromen-3-yl)imidazo[2,1-b][1,3]benzothiazole-6-sulfonamide is sourced from PubChem (CID 71570660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).