C7H9NO2S2 — CID 71600515
7-methyl-1,4-dithia-7-azaspiro[4.4]nonane-6,8-dione (PubChem CID 71600515) has the molecular formula C7H9NO2S2 and a molecular weight of 203.29 g/mol. Its IUPAC name is 7-methyl-1,4-dithia-7-azaspiro[4.4]nonane-6,8-dione.
| Compound Name | 7-methyl-1,4-dithia-7-azaspiro[4.4]nonane-6,8-dione |
|---|---|
| PubChem CID | 71600515 |
| Molecular Formula | C7H9NO2S2 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.01 |
| IUPAC Name | 7-methyl-1,4-dithia-7-azaspiro[4.4]nonane-6,8-dione |
| SMILES | CN1C(=O)CC2(SCCS2)C1=O |
| InChI | InChI=1S/C7H9NO2S2/c1-8-5(9)4-7(6(8)10)11-2-3-12-7/h2-4H2,1H3 |
| InChIKey | FLKNULVOMJRDKR-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|