C30H31Cl2N5O — CID 71602529
N-[(1R)-2-[[5-chloro-2-(5-chloro-2-pyridinyl)-6-methylpyrimidin-4-yl]amino]-1-phenylethyl]-6-phenylhexanamide (PubChem CID 71602529) has the molecular formula C30H31Cl2N5O and a molecular weight of 548.52 g/mol. Its IUPAC name is N-[(1R)-2-[[5-chloro-2-(5-chloro-2-pyridinyl)-6-methylpyrimidin-4-yl]amino]-1-phenylethyl]-6-phenylhexanamide.
| Compound Name | N-[(1R)-2-[[5-chloro-2-(5-chloro-2-pyridinyl)-6-methylpyrimidin-4-yl]amino]-1-phenylethyl]-6-phenylhexanamide |
|---|---|
| PubChem CID | 71602529 |
| Molecular Formula | C30H31Cl2N5O |
| Molecular Weight | 548.52 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | N-[(1R)-2-[[5-chloro-2-(5-chloro-2-pyridinyl)-6-methylpyrimidin-4-yl]amino]-1-phenylethyl]-6-phenylhexanamide |
| SMILES | Cc1nc(-c2ccc(Cl)cn2)nc(NC[C@H](NC(=O)CCCCCc2ccccc2)c2ccccc2)c1Cl |
| InChI | InChI=1S/C30H31Cl2N5O/c1-21-28(32)30(37-29(35-21)25-18-17-24(31)19-33-25)34-20-26(23-14-8-4-9-15-23)36-27(38)16-10-3-7-13-22-11-5-2-6-12-22/h2,4-6,8-9,11-12,14-15,17-19,26H,3,7,10,13,16,20H2,1H3,(H,36,38)(H,34,35,37)/t26-/m0/s1 |
| InChIKey | UTVBIOYKIWRMTJ-SANMLTNESA-N |
| XLogP | 7.23 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.52 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|