C19H13Cl3O4 — CID 71609165
3,6,8-trichloro-2-(3-methoxy-4-prop-2-enoxyphenyl)chromen-4-one (PubChem CID 71609165) has the molecular formula C19H13Cl3O4 and a molecular weight of 411.67 g/mol. Its IUPAC name is 3,6,8-trichloro-2-(3-methoxy-4-prop-2-enoxyphenyl)chromen-4-one.
| Compound Name | 3,6,8-trichloro-2-(3-methoxy-4-prop-2-enoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 71609165 |
| Molecular Formula | C19H13Cl3O4 |
| Molecular Weight | 411.67 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | 3,6,8-trichloro-2-(3-methoxy-4-prop-2-enoxyphenyl)chromen-4-one |
| SMILES | C=CCOc1ccc(-c2oc3c(Cl)cc(Cl)cc3c(=O)c2Cl)cc1OC |
| InChI | InChI=1S/C19H13Cl3O4/c1-3-6-25-14-5-4-10(7-15(14)24-2)18-16(22)17(23)12-8-11(20)9-13(21)19(12)26-18/h3-5,7-9H,1,6H2,2H3 |
| InChIKey | PMQOBMGFKFSUCM-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.67 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|