C28H23N7 — CID 71653166
N,N-dimethyl-4-[(E)-[(Z)-(12-methyl-14-phenyl-10,13,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11(15),12-heptaen-8-ylidene)hydrazinylidene]methyl]aniline (PubChem CID 71653166) has the molecular formula C28H23N7 and a molecular weight of 457.54 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-[(Z)-(12-methyl-14-phenyl-10,13,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11(15),12-heptaen-8-ylidene)hydrazinylidene]methyl]aniline.
| Compound Name | N,N-dimethyl-4-[(E)-[(Z)-(12-methyl-14-phenyl-10,13,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11(15),12-heptaen-8-ylidene)hydrazinylidene]methyl]aniline |
|---|---|
| PubChem CID | 71653166 |
| Molecular Formula | C28H23N7 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | N,N-dimethyl-4-[(E)-[(Z)-(12-methyl-14-phenyl-10,13,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11(15),12-heptaen-8-ylidene)hydrazinylidene]methyl]aniline |
| SMILES | Cc1nn(-c2ccccc2)c2nc3c(nc12)/C(=N\N=C\c1ccc(N(C)C)cc1)c1ccccc1-3 |
| InChI | InChI=1S/C28H23N7/c1-18-24-28(35(33-18)21-9-5-4-6-10-21)31-25-22-11-7-8-12-23(22)26(27(25)30-24)32-29-17-19-13-15-20(16-14-19)34(2)3/h4-17H,1-3H3/b29-17+,32-26- |
| InChIKey | XNVRURJIUVGMNI-ZIAPKVEUSA-N |
| XLogP | 5.04 |
| TPSA | 71.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_J(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|