C17H15N7 — CID 10495696
7,14-dimethyl-12-phenyl-3,6,8,10,12,13,16-heptazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2,7,9,11(15),13-hexaene (PubChem CID 10495696) has the molecular formula C17H15N7 and a molecular weight of 317.36 g/mol. Its IUPAC name is 7,14-dimethyl-12-phenyl-3,6,8,10,12,13,16-heptazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2,7,9,11(15),13-hexaene.
| Compound Name | 7,14-dimethyl-12-phenyl-3,6,8,10,12,13,16-heptazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2,7,9,11(15),13-hexaene |
|---|---|
| PubChem CID | 10495696 |
| Molecular Formula | C17H15N7 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 7,14-dimethyl-12-phenyl-3,6,8,10,12,13,16-heptazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2,7,9,11(15),13-hexaene |
| SMILES | CC1=Nc2nc3c(nc2C2=NCCN12)c(C)nn3-c1ccccc1 |
| InChI | InChI=1S/C17H15N7/c1-10-13-17(24(22-10)12-6-4-3-5-7-12)21-15-14(20-13)16-18-8-9-23(16)11(2)19-15/h3-7H,8-9H2,1-2H3 |
| InChIKey | DJRPMQNOBUEGMC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 71.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |