C27H22N6 — CID 71653312
N,N-dimethyl-4-[(12-methyl-14-phenyl-10,13,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11(15),12-heptaen-8-ylidene)amino]aniline (PubChem CID 71653312) has the molecular formula C27H22N6 and a molecular weight of 430.52 g/mol. Its IUPAC name is N,N-dimethyl-4-[(12-methyl-14-phenyl-10,13,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11(15),12-heptaen-8-ylidene)amino]aniline.
| Compound Name | N,N-dimethyl-4-[(12-methyl-14-phenyl-10,13,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11(15),12-heptaen-8-ylidene)amino]aniline |
|---|---|
| PubChem CID | 71653312 |
| Molecular Formula | C27H22N6 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N,N-dimethyl-4-[(12-methyl-14-phenyl-10,13,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11(15),12-heptaen-8-ylidene)amino]aniline |
| SMILES | Cc1nn(-c2ccccc2)c2nc3c(nc12)/C(=N/c1ccc(N(C)C)cc1)c1ccccc1-3 |
| InChI | InChI=1S/C27H22N6/c1-17-23-27(33(31-17)20-9-5-4-6-10-20)30-25-22-12-8-7-11-21(22)24(26(25)29-23)28-18-13-15-19(16-14-18)32(2)3/h4-16H,1-3H3/b28-24+ |
| InChIKey | PBYYSQSDMMGIIP-ZZIIXHQDSA-N |
| XLogP | 5.34 |
| TPSA | 59.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|