C16H13N7S — CID 135536773
14-methyl-12-phenyl-3,6,8,10,12,13,16-heptazatetracyclo[7.7.0.02,6.011,15]hexadeca-1,8,10,13,15-pentaene-7-thione (PubChem CID 135536773) has the molecular formula C16H13N7S and a molecular weight of 335.40 g/mol. Its IUPAC name is 14-methyl-12-phenyl-3,6,8,10,12,13,16-heptazatetracyclo[7.7.0.02,6.011,15]hexadeca-1,8,10,13,15-pentaene-7-thione.
| Compound Name | 14-methyl-12-phenyl-3,6,8,10,12,13,16-heptazatetracyclo[7.7.0.02,6.011,15]hexadeca-1,8,10,13,15-pentaene-7-thione |
|---|---|
| PubChem CID | 135536773 |
| Molecular Formula | C16H13N7S |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 14-methyl-12-phenyl-3,6,8,10,12,13,16-heptazatetracyclo[7.7.0.02,6.011,15]hexadeca-1,8,10,13,15-pentaene-7-thione |
| SMILES | Cc1nn(-c2ccccc2)c2nc3nc(=S)n4c(c3nc12)NCC4 |
| InChI | InChI=1S/C16H13N7S/c1-9-11-15(23(21-9)10-5-3-2-4-6-10)19-13-12(18-11)14-17-7-8-22(14)16(24)20-13/h2-6,17H,7-8H2,1H3 |
| InChIKey | DEXGQKQGAHKFTB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|