C23H32F6N2O4S — CID 71656711
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[2,4,6-tri(propan-2-yl)phenyl]sulfonylpiperazine-1-carboxylate (PubChem CID 71656711) has the molecular formula C23H32F6N2O4S and a molecular weight of 546.57 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[2,4,6-tri(propan-2-yl)phenyl]sulfonylpiperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[2,4,6-tri(propan-2-yl)phenyl]sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 71656711 |
| Molecular Formula | C23H32F6N2O4S |
| Molecular Weight | 546.57 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[2,4,6-tri(propan-2-yl)phenyl]sulfonylpiperazine-1-carboxylate |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)N2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)c(C(C)C)c1 |
| InChI | InChI=1S/C23H32F6N2O4S/c1-13(2)16-11-17(14(3)4)19(18(12-16)15(5)6)36(33,34)31-9-7-30(8-10-31)21(32)35-20(22(24,25)26)23(27,28)29/h11-15,20H,7-10H2,1-6H3 |
| InChIKey | YMBJQCFOEHPCBM-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.57 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |