C20H18ClFN4O3S2 — CID 71657356
2-[[3-chloro-2-[(dimethylcarbamothioylamino)carbamoyl]-1-benzothiophen-6-yl]oxy]-N-(2-fluorophenyl)acetamide (PubChem CID 71657356) has the molecular formula C20H18ClFN4O3S2 and a molecular weight of 480.97 g/mol. Its IUPAC name is 2-[[3-chloro-2-[(dimethylcarbamothioylamino)carbamoyl]-1-benzothiophen-6-yl]oxy]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[[3-chloro-2-[(dimethylcarbamothioylamino)carbamoyl]-1-benzothiophen-6-yl]oxy]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 71657356 |
| Molecular Formula | C20H18ClFN4O3S2 |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 2-[[3-chloro-2-[(dimethylcarbamothioylamino)carbamoyl]-1-benzothiophen-6-yl]oxy]-N-(2-fluorophenyl)acetamide |
| SMILES | CN(C)C(=S)NNC(=O)c1sc2cc(OCC(=O)Nc3ccccc3F)ccc2c1Cl |
| InChI | InChI=1S/C20H18ClFN4O3S2/c1-26(2)20(30)25-24-19(28)18-17(21)12-8-7-11(9-15(12)31-18)29-10-16(27)23-14-6-4-3-5-13(14)22/h3-9H,10H2,1-2H3,(H,23,27)(H,24,28)(H,25,30) |
| InChIKey | HJNOOUWAAKNHGL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|