About pyrrolidine-1-carbodithioate;pyrrolidin-1-ium
pyrrolidine-1-carbodithioate;pyrrolidin-1-ium (PubChem CID 71677616) has the molecular formula C9H18N2S2
and a molecular weight of 218.39 g/mol. Its IUPAC name is pyrrolidine-1-carbodithioate;pyrrolidin-1-ium.
Molecular Properties
| Compound Name | pyrrolidine-1-carbodithioate;pyrrolidin-1-ium |
| PubChem CID | 71677616 |
| Molecular Formula | C9H18N2S2 |
| Molecular Weight | 218.39 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | pyrrolidine-1-carbodithioate;pyrrolidin-1-ium |
| SMILES | C1CC[NH2+]C1.S=C([S-])N1CCCC1 |
| InChI | InChI=1S/C5H9NS2.C4H9N/c7-5(8)6-3-1-2-4-6;1-2-4-5-3-1/h1-4H2,(H,7,8);5H,1-4H2 |
| InChIKey | FZIPKYLCJDUBKI-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 19.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.39 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze pyrrolidine-1-carbodithioate;pyrrolidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidine-1-carbodithioate;pyrrolidin-1-ium?
The IUPAC name of pyrrolidine-1-carbodithioate;pyrrolidin-1-ium (CID 71677616) is pyrrolidine-1-carbodithioate;pyrrolidin-1-ium.
What is the SMILES notation for pyrrolidine-1-carbodithioate;pyrrolidin-1-ium?
The canonical SMILES for pyrrolidine-1-carbodithioate;pyrrolidin-1-ium is C1CC[NH2+]C1.S=C([S-])N1CCCC1.
What is the InChIKey of pyrrolidine-1-carbodithioate;pyrrolidin-1-ium?
The InChIKey is FZIPKYLCJDUBKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NS2.C4H9N/c7-5(8)6-3-1-2-4-6;1-2-4-5-3-1/h1-4H2,(H,7,8);5H,1-4H2.
What are the key properties of pyrrolidine-1-carbodithioate;pyrrolidin-1-ium?
pyrrolidine-1-carbodithioate;pyrrolidin-1-ium has a molecular weight of 218.39 g/mol, XLogP of 0.26, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidine-1-carbodithioate;pyrrolidin-1-ium is sourced from PubChem (CID 71677616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).