C30H51IO5Si — CID 71681767
(1S,3S,5R,7S,11R,13E,17R)-11-[(E)-2-iodoethenyl]-5-tri(propan-2-yl)silyloxy-10,21,22-trioxatricyclo[15.3.1.13,7]docos-13-en-9-one (PubChem CID 71681767) has the molecular formula C30H51IO5Si and a molecular weight of 646.72 g/mol. Its IUPAC name is (1S,3S,5R,7S,11R,13E,17R)-11-[(E)-2-iodoethenyl]-5-tri(propan-2-yl)silyloxy-10,21,22-trioxatricyclo[15.3.1.13,7]docos-13-en-9-one.
| Compound Name | (1S,3S,5R,7S,11R,13E,17R)-11-[(E)-2-iodoethenyl]-5-tri(propan-2-yl)silyloxy-10,21,22-trioxatricyclo[15.3.1.13,7]docos-13-en-9-one |
|---|---|
| PubChem CID | 71681767 |
| Molecular Formula | C30H51IO5Si |
| Molecular Weight | 646.72 g/mol |
| Exact Mass | 646.26 |
| IUPAC Name | (1S,3S,5R,7S,11R,13E,17R)-11-[(E)-2-iodoethenyl]-5-tri(propan-2-yl)silyloxy-10,21,22-trioxatricyclo[15.3.1.13,7]docos-13-en-9-one |
| SMILES | CC(C)[Si](O[C@H]1C[C@H]2CC(=O)O[C@@H](/C=C/I)C/C=C/CC[C@H]3CCC[C@@H](C[C@@H](C1)O2)O3)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H51IO5Si/c1-21(2)37(22(3)4,23(5)6)36-29-18-27-17-26-14-10-13-24(33-26)11-8-7-9-12-25(15-16-31)35-30(32)20-28(19-29)34-27/h7,9,15-16,21-29H,8,10-14,17-20H2,1-6H3/b9-7+,16-15+/t24-,25+,26-,27-,28-,29+/m0/s1 |
| InChIKey | LCUNCCMFJBNPPF-FMBIOSSTSA-N |
| XLogP | 8.41 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.72 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|