C10H18O3Si — CID 71723523
[(2R,3S)-3-[(2S,3R)-3-[(E)-2-trimethylsilylethenyl]oxiran-2-yl]oxiran-2-yl]methanol (PubChem CID 71723523) has the molecular formula C10H18O3Si and a molecular weight of 214.34 g/mol. Its IUPAC name is [(2R,3S)-3-[(2S,3R)-3-[(E)-2-trimethylsilylethenyl]oxiran-2-yl]oxiran-2-yl]methanol.
| Compound Name | [(2R,3S)-3-[(2S,3R)-3-[(E)-2-trimethylsilylethenyl]oxiran-2-yl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 71723523 |
| Molecular Formula | C10H18O3Si |
| Molecular Weight | 214.34 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | [(2R,3S)-3-[(2S,3R)-3-[(E)-2-trimethylsilylethenyl]oxiran-2-yl]oxiran-2-yl]methanol |
| SMILES | C[Si](C)(C)/C=C/[C@H]1O[C@@H]1[C@H]1O[C@@H]1CO |
| InChI | InChI=1S/C10H18O3Si/c1-14(2,3)5-4-7-9(12-7)10-8(6-11)13-10/h4-5,7-11H,6H2,1-3H3/b5-4+/t7-,8-,9+,10+/m1/s1 |
| InChIKey | GMWZGNCCGMOYRM-WGQXLFFKSA-N |
| XLogP | 0.95 |
| TPSA | 45.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|