C42H60O6Si — CID 71726207
(1S,3S,7R,9S,12E,15R)-9-[(Z,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pent-1-enyl]-2,2,5,5-tetramethyl-4,6,10,19-tetraoxatricyclo[13.3.1.13,7]icos-12-en-11-one (PubChem CID 71726207) has the molecular formula C42H60O6Si and a molecular weight of 689.02 g/mol. Its IUPAC name is (1S,3S,7R,9S,12E,15R)-9-[(Z,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pent-1-enyl]-2,2,5,5-tetramethyl-4,6,10,19-tetraoxatricyclo[13.3.1.13,7]icos-12-en-11-one.
| Compound Name | (1S,3S,7R,9S,12E,15R)-9-[(Z,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pent-1-enyl]-2,2,5,5-tetramethyl-4,6,10,19-tetraoxatricyclo[13.3.1.13,7]icos-12-en-11-one |
|---|---|
| PubChem CID | 71726207 |
| Molecular Formula | C42H60O6Si |
| Molecular Weight | 689.02 g/mol |
| Exact Mass | 688.42 |
| IUPAC Name | (1S,3S,7R,9S,12E,15R)-9-[(Z,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pent-1-enyl]-2,2,5,5-tetramethyl-4,6,10,19-tetraoxatricyclo[13.3.1.13,7]icos-12-en-11-one |
| SMILES | CC[C@H](/C=C\[C@@H]1C[C@@H]2C[C@H](OC(C)(C)O2)C(C)(C)[C@@H]2CCC[C@H](C/C=C\C(=O)O1)O2)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C42H60O6Si/c1-9-31(30-44-49(40(2,3)4,35-20-12-10-13-21-35)36-22-14-11-15-23-36)26-27-33-28-34-29-38(48-42(7,8)47-34)41(5,6)37-24-16-18-32(45-37)19-17-25-39(43)46-33/h10-15,17,20-23,25-27,31-34,37-38H,9,16,18-19,24,28-30H2,1-8H3/b25-17-,27-26-/t31-,32-,33-,34-,37+,38+/m1/s1 |
| InChIKey | UYCMARWXCSKJNM-YUAWWZFDSA-N |
| XLogP | 8.28 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.02 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|