C20H20N2O6 — CID 71728226
3-benzyl-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-1,3-oxazolidine-5-carboxamide (PubChem CID 71728226) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is 3-benzyl-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-1,3-oxazolidine-5-carboxamide.
| Compound Name | 3-benzyl-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 71728226 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 3-benzyl-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-1,3-oxazolidine-5-carboxamide |
| SMILES | COc1cc(CNC(=O)C2OC(=O)N(Cc3ccccc3)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C20H20N2O6/c1-26-15-8-14(9-16(10-15)27-2)11-21-18(23)17-19(24)22(20(25)28-17)12-13-6-4-3-5-7-13/h3-10,17H,11-12H2,1-2H3,(H,21,23) |
| InChIKey | DMDWNLSVHZKAJO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|