C42H43NO6 — CID 7173268
N-benzyl-1-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanimine oxide (PubChem CID 7173268) has the molecular formula C42H43NO6 and a molecular weight of 657.81 g/mol. Its IUPAC name is N-benzyl-1-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanimine oxide.
| Compound Name | N-benzyl-1-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanimine oxide |
|---|---|
| PubChem CID | 7173268 |
| Molecular Formula | C42H43NO6 |
| Molecular Weight | 657.81 g/mol |
| Exact Mass | 657.31 |
| IUPAC Name | N-benzyl-1-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanimine oxide |
| SMILES | [O-]/[N+](=C\[C@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C42H43NO6/c44-43(26-33-16-6-1-7-17-33)27-38-40(46-29-35-20-10-3-11-21-35)42(48-31-37-24-14-5-15-25-37)41(47-30-36-22-12-4-13-23-36)39(49-38)32-45-28-34-18-8-2-9-19-34/h1-25,27,38-42H,26,28-32H2/b43-27-/t38-,39-,40+,41+,42-/m1/s1 |
| InChIKey | NWZTVCGFGSYLCZ-FVTQZLACSA-N |
| XLogP | 7.51 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.81 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|