C22H29NO2 — CID 71751166
[(3S,6S)-1,1,1-trideuterio-6-(methylamino)-4,4-diphenylheptan-3-yl] acetate (PubChem CID 71751166) has the molecular formula C22H29NO2 and a molecular weight of 342.50 g/mol. Its IUPAC name is [(3S,6S)-1,1,1-trideuterio-6-(methylamino)-4,4-diphenylheptan-3-yl] acetate.
| Compound Name | [(3S,6S)-1,1,1-trideuterio-6-(methylamino)-4,4-diphenylheptan-3-yl] acetate |
|---|---|
| PubChem CID | 71751166 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | [(3S,6S)-1,1,1-trideuterio-6-(methylamino)-4,4-diphenylheptan-3-yl] acetate |
| SMILES | [2H]C([2H])([2H])C[C@H](OC(C)=O)C(C[C@H](C)NC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29NO2/c1-5-21(25-18(3)24)22(16-17(2)23-4,19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-15,17,21,23H,5,16H2,1-4H3/t17-,21-/m0/s1/i1D3 |
| InChIKey | VWCUGCYZZGRKEE-XBFUWUMBSA-N |
| XLogP | 4.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |