C31H37NO7S — CID 71763058
[(1R)-1-[(2R,3aR,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]ethyl] methanesulfonate (PubChem CID 71763058) has the molecular formula C31H37NO7S and a molecular weight of 567.70 g/mol. Its IUPAC name is [(1R)-1-[(2R,3aR,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]ethyl] methanesulfonate.
| Compound Name | [(1R)-1-[(2R,3aR,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]ethyl] methanesulfonate |
|---|---|
| PubChem CID | 71763058 |
| Molecular Formula | C31H37NO7S |
| Molecular Weight | 567.70 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | [(1R)-1-[(2R,3aR,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]ethyl] methanesulfonate |
| SMILES | C[C@@H](OS(C)(=O)=O)[C@H]1C[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](COCc3ccccc3)N2O1 |
| InChI | InChI=1S/C31H37NO7S/c1-23(39-40(2,33)34)29-18-27-30(36-20-25-14-8-4-9-15-25)31(37-21-26-16-10-5-11-17-26)28(32(27)38-29)22-35-19-24-12-6-3-7-13-24/h3-17,23,27-31H,18-22H2,1-2H3/t23-,27-,28-,29-,30-,31-/m1/s1 |
| InChIKey | AZFHLNMLFFXMSJ-BMPASMRQSA-N |
| XLogP | 4.50 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.70 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|