C20H20N4 — CID 71764316
(2S,9S)-2,4-diphenyl-1,5,6,7-tetrazatricyclo[7.3.0.03,7]dodeca-3,5-diene (PubChem CID 71764316) has the molecular formula C20H20N4 and a molecular weight of 316.41 g/mol. Its IUPAC name is (2S,9S)-2,4-diphenyl-1,5,6,7-tetrazatricyclo[7.3.0.03,7]dodeca-3,5-diene.
| Compound Name | (2S,9S)-2,4-diphenyl-1,5,6,7-tetrazatricyclo[7.3.0.03,7]dodeca-3,5-diene |
|---|---|
| PubChem CID | 71764316 |
| Molecular Formula | C20H20N4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (2S,9S)-2,4-diphenyl-1,5,6,7-tetrazatricyclo[7.3.0.03,7]dodeca-3,5-diene |
| SMILES | c1ccc(-c2nnn3c2[C@H](c2ccccc2)N2CCC[C@H]2C3)cc1 |
| InChI | InChI=1S/C20H20N4/c1-3-8-15(9-4-1)18-20-19(16-10-5-2-6-11-16)23-13-7-12-17(23)14-24(20)22-21-18/h1-6,8-11,17,19H,7,12-14H2/t17-,19-/m0/s1 |
| InChIKey | NHDUAZJRHLXJCI-HKUYNNGSSA-N |
| XLogP | 3.51 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |