C36H45NO2SSi — CID 71764726
(NE)-N-[2-(2-adamantyl)-3-[tert-butyl(diphenyl)silyl]-1,2-dideuteriopropylidene]-4-methylbenzenesulfonamide (PubChem CID 71764726) has the molecular formula C36H45NO2SSi and a molecular weight of 585.93 g/mol. Its IUPAC name is (NE)-N-[2-(2-adamantyl)-3-[tert-butyl(diphenyl)silyl]-1,2-dideuteriopropylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NE)-N-[2-(2-adamantyl)-3-[tert-butyl(diphenyl)silyl]-1,2-dideuteriopropylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 71764726 |
| Molecular Formula | C36H45NO2SSi |
| Molecular Weight | 585.93 g/mol |
| Exact Mass | 585.31 |
| IUPAC Name | (NE)-N-[2-(2-adamantyl)-3-[tert-butyl(diphenyl)silyl]-1,2-dideuteriopropylidene]-4-methylbenzenesulfonamide |
| SMILES | [2H]/C(=N\S(=O)(=O)c1ccc(C)cc1)C([2H])(C[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C36H45NO2SSi/c1-26-15-17-32(18-16-26)40(38,39)37-24-31(35-29-20-27-19-28(22-29)23-30(35)21-27)25-41(36(2,3)4,33-11-7-5-8-12-33)34-13-9-6-10-14-34/h5-18,24,27-31,35H,19-23,25H2,1-4H3/b37-24+/i24D,31D |
| InChIKey | HQYIQPLOJMZQLK-JTIWQQTCSA-N |
| XLogP | 7.51 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.93 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|