C30H25IN2O4 — CID 71769119
19-hydroxy-18-(2-hydroxy-5-iodophenyl)-1,8-diazahexacyclo[17.7.0.02,7.09,17.010,15.020,25]hexacosa-9(17),10,12,14,20,22,24-heptaene-16,26-dione (PubChem CID 71769119) has the molecular formula C30H25IN2O4 and a molecular weight of 604.44 g/mol. Its IUPAC name is 19-hydroxy-18-(2-hydroxy-5-iodophenyl)-1,8-diazahexacyclo[17.7.0.02,7.09,17.010,15.020,25]hexacosa-9(17),10,12,14,20,22,24-heptaene-16,26-dione.
| Compound Name | 19-hydroxy-18-(2-hydroxy-5-iodophenyl)-1,8-diazahexacyclo[17.7.0.02,7.09,17.010,15.020,25]hexacosa-9(17),10,12,14,20,22,24-heptaene-16,26-dione |
|---|---|
| PubChem CID | 71769119 |
| Molecular Formula | C30H25IN2O4 |
| Molecular Weight | 604.44 g/mol |
| Exact Mass | 604.09 |
| IUPAC Name | 19-hydroxy-18-(2-hydroxy-5-iodophenyl)-1,8-diazahexacyclo[17.7.0.02,7.09,17.010,15.020,25]hexacosa-9(17),10,12,14,20,22,24-heptaene-16,26-dione |
| SMILES | O=C1C2=C(NC3CCCCC3N3C(=O)c4ccccc4C3(O)C2c2cc(I)ccc2O)c2ccccc21 |
| InChI | InChI=1S/C30H25IN2O4/c31-16-13-14-24(34)20(15-16)26-25-27(17-7-1-2-8-18(17)28(25)35)32-22-11-5-6-12-23(22)33-29(36)19-9-3-4-10-21(19)30(26,33)37/h1-4,7-10,13-15,22-23,26,32,34,37H,5-6,11-12H2 |
| InChIKey | XIVVWRRJVWQWOM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|