C28H24N2O5 — CID 71770882
3-hydroxy-2-(2-hydroxy-5-methoxyphenyl)-13-methyl-11,14-diazapentacyclo[13.7.0.03,11.04,9.016,21]docosa-1(15),4,6,8,16,18,20-heptaene-10,22-dione (PubChem CID 71770882) has the molecular formula C28H24N2O5 and a molecular weight of 468.51 g/mol. Its IUPAC name is 3-hydroxy-2-(2-hydroxy-5-methoxyphenyl)-13-methyl-11,14-diazapentacyclo[13.7.0.03,11.04,9.016,21]docosa-1(15),4,6,8,16,18,20-heptaene-10,22-dione.
| Compound Name | 3-hydroxy-2-(2-hydroxy-5-methoxyphenyl)-13-methyl-11,14-diazapentacyclo[13.7.0.03,11.04,9.016,21]docosa-1(15),4,6,8,16,18,20-heptaene-10,22-dione |
|---|---|
| PubChem CID | 71770882 |
| Molecular Formula | C28H24N2O5 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 3-hydroxy-2-(2-hydroxy-5-methoxyphenyl)-13-methyl-11,14-diazapentacyclo[13.7.0.03,11.04,9.016,21]docosa-1(15),4,6,8,16,18,20-heptaene-10,22-dione |
| SMILES | COc1ccc(O)c(C2C3=C(NC(C)CN4C(=O)c5ccccc5C24O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C28H24N2O5/c1-15-14-30-27(33)19-9-5-6-10-21(19)28(30,34)24(20-13-16(35-2)11-12-22(20)31)23-25(29-15)17-7-3-4-8-18(17)26(23)32/h3-13,15,24,29,31,34H,14H2,1-2H3 |
| InChIKey | VWZKSTVAMNJZII-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |