C26H18Cl2N2O4 — CID 102114609
(2R,3S)-2-(3,5-dichloro-2-hydroxyphenyl)-3-hydroxy-11,14-diazapentacyclo[13.7.0.03,11.04,9.016,21]docosa-1(15),4,6,8,16,18,20-heptaene-10,22-dione (PubChem CID 102114609) has the molecular formula C26H18Cl2N2O4 and a molecular weight of 493.35 g/mol. Its IUPAC name is (2R,3S)-2-(3,5-dichloro-2-hydroxyphenyl)-3-hydroxy-11,14-diazapentacyclo[13.7.0.03,11.04,9.016,21]docosa-1(15),4,6,8,16,18,20-heptaene-10,22-dione.
| Compound Name | (2R,3S)-2-(3,5-dichloro-2-hydroxyphenyl)-3-hydroxy-11,14-diazapentacyclo[13.7.0.03,11.04,9.016,21]docosa-1(15),4,6,8,16,18,20-heptaene-10,22-dione |
|---|---|
| PubChem CID | 102114609 |
| Molecular Formula | C26H18Cl2N2O4 |
| Molecular Weight | 493.35 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | (2R,3S)-2-(3,5-dichloro-2-hydroxyphenyl)-3-hydroxy-11,14-diazapentacyclo[13.7.0.03,11.04,9.016,21]docosa-1(15),4,6,8,16,18,20-heptaene-10,22-dione |
| SMILES | O=C1C2=C(NCCN3C(=O)c4ccccc4[C@@]3(O)[C@@H]2c2cc(Cl)cc(Cl)c2O)c2ccccc21 |
| InChI | InChI=1S/C26H18Cl2N2O4/c27-13-11-17(23(31)19(28)12-13)21-20-22(14-5-1-2-6-15(14)24(20)32)29-9-10-30-25(33)16-7-3-4-8-18(16)26(21,30)34/h1-8,11-12,21,29,31,34H,9-10H2/t21-,26-/m1/s1 |
| InChIKey | FLQCAWQCIYWIAK-QFQXNSOFSA-N |
| XLogP | 4.29 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |