C27H21ClN2O4 — CID 102114608
(2S,3R)-2-(5-chloro-2-hydroxy-4-methylphenyl)-3-hydroxy-11,14-diazapentacyclo[13.7.0.03,11.04,9.016,21]docosa-1(15),4,6,8,16,18,20-heptaene-10,22-dione (PubChem CID 102114608) has the molecular formula C27H21ClN2O4 and a molecular weight of 472.93 g/mol. Its IUPAC name is (2S,3R)-2-(5-chloro-2-hydroxy-4-methylphenyl)-3-hydroxy-11,14-diazapentacyclo[13.7.0.03,11.04,9.016,21]docosa-1(15),4,6,8,16,18,20-heptaene-10,22-dione.
| Compound Name | (2S,3R)-2-(5-chloro-2-hydroxy-4-methylphenyl)-3-hydroxy-11,14-diazapentacyclo[13.7.0.03,11.04,9.016,21]docosa-1(15),4,6,8,16,18,20-heptaene-10,22-dione |
|---|---|
| PubChem CID | 102114608 |
| Molecular Formula | C27H21ClN2O4 |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | (2S,3R)-2-(5-chloro-2-hydroxy-4-methylphenyl)-3-hydroxy-11,14-diazapentacyclo[13.7.0.03,11.04,9.016,21]docosa-1(15),4,6,8,16,18,20-heptaene-10,22-dione |
| SMILES | Cc1cc(O)c([C@H]2C3=C(NCCN4C(=O)c5ccccc5[C@]24O)c2ccccc2C3=O)cc1Cl |
| InChI | InChI=1S/C27H21ClN2O4/c1-14-12-21(31)18(13-20(14)28)23-22-24(15-6-2-3-7-16(15)25(22)32)29-10-11-30-26(33)17-8-4-5-9-19(17)27(23,30)34/h2-9,12-13,23,29,31,34H,10-11H2,1H3/t23-,27-/m0/s1 |
| InChIKey | RRPHXMJFKYFDQK-HOFKKMOUSA-N |
| XLogP | 3.95 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |