C31H28N2O4 — CID 71771003
(2S,7S,18R,19S)-19-hydroxy-18-(2-hydroxy-5-methylphenyl)-1,8-diazahexacyclo[17.7.0.02,7.09,17.010,15.020,25]hexacosa-9(17),10,12,14,20,22,24-heptaene-16,26-dione (PubChem CID 71771003) has the molecular formula C31H28N2O4 and a molecular weight of 492.58 g/mol. Its IUPAC name is (2S,7S,18R,19S)-19-hydroxy-18-(2-hydroxy-5-methylphenyl)-1,8-diazahexacyclo[17.7.0.02,7.09,17.010,15.020,25]hexacosa-9(17),10,12,14,20,22,24-heptaene-16,26-dione.
| Compound Name | (2S,7S,18R,19S)-19-hydroxy-18-(2-hydroxy-5-methylphenyl)-1,8-diazahexacyclo[17.7.0.02,7.09,17.010,15.020,25]hexacosa-9(17),10,12,14,20,22,24-heptaene-16,26-dione |
|---|---|
| PubChem CID | 71771003 |
| Molecular Formula | C31H28N2O4 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | (2S,7S,18R,19S)-19-hydroxy-18-(2-hydroxy-5-methylphenyl)-1,8-diazahexacyclo[17.7.0.02,7.09,17.010,15.020,25]hexacosa-9(17),10,12,14,20,22,24-heptaene-16,26-dione |
| SMILES | Cc1ccc(O)c([C@@H]2C3=C(N[C@H]4CCCC[C@@H]4N4C(=O)c5ccccc5[C@@]24O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C31H28N2O4/c1-17-14-15-25(34)21(16-17)27-26-28(18-8-2-3-9-19(18)29(26)35)32-23-12-6-7-13-24(23)33-30(36)20-10-4-5-11-22(20)31(27,33)37/h2-5,8-11,14-16,23-24,27,32,34,37H,6-7,12-13H2,1H3/t23-,24-,27+,31+/m0/s1 |
| InChIKey | LMBONSBLNAQTML-NFCLTKQRSA-N |
| XLogP | 4.61 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |