C23H22N4O5 — CID 71850059
5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxy-N-[3-(1,2,4-oxadiazol-5-yl)propyl]benzamide (PubChem CID 71850059) has the molecular formula C23H22N4O5 and a molecular weight of 434.45 g/mol. Its IUPAC name is 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxy-N-[3-(1,2,4-oxadiazol-5-yl)propyl]benzamide.
| Compound Name | 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxy-N-[3-(1,2,4-oxadiazol-5-yl)propyl]benzamide |
|---|---|
| PubChem CID | 71850059 |
| Molecular Formula | C23H22N4O5 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxy-N-[3-(1,2,4-oxadiazol-5-yl)propyl]benzamide |
| SMILES | CCOc1ccc(CN2C(=O)c3ccccc3C2=O)cc1C(=O)NCCCc1ncno1 |
| InChI | InChI=1S/C23H22N4O5/c1-2-31-19-10-9-15(13-27-22(29)16-6-3-4-7-17(16)23(27)30)12-18(19)21(28)24-11-5-8-20-25-14-26-32-20/h3-4,6-7,9-10,12,14H,2,5,8,11,13H2,1H3,(H,24,28) |
| InChIKey | ZZRCWPRSKVMYNR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|