C19H21NO6S — CID 71851420
5-[[4-(2-carboxypropan-2-yl)phenyl]sulfamoyl]-2,3-dimethylbenzoic acid (PubChem CID 71851420) has the molecular formula C19H21NO6S and a molecular weight of 391.45 g/mol. Its IUPAC name is 5-[[4-(2-carboxypropan-2-yl)phenyl]sulfamoyl]-2,3-dimethylbenzoic acid.
| Compound Name | 5-[[4-(2-carboxypropan-2-yl)phenyl]sulfamoyl]-2,3-dimethylbenzoic acid |
|---|---|
| PubChem CID | 71851420 |
| Molecular Formula | C19H21NO6S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 5-[[4-(2-carboxypropan-2-yl)phenyl]sulfamoyl]-2,3-dimethylbenzoic acid |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccc(C(C)(C)C(=O)O)cc2)cc(C(=O)O)c1C |
| InChI | InChI=1S/C19H21NO6S/c1-11-9-15(10-16(12(11)2)17(21)22)27(25,26)20-14-7-5-13(6-8-14)19(3,4)18(23)24/h5-10,20H,1-4H3,(H,21,22)(H,23,24) |
| InChIKey | QUJDXAFDJKDWDP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |