C15H23N7O2 — CID 71856846
1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-[1-(5-methyl-1,2,4-oxadiazol-3-yl)propyl]urea (PubChem CID 71856846) has the molecular formula C15H23N7O2 and a molecular weight of 333.40 g/mol. Its IUPAC name is 1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-[1-(5-methyl-1,2,4-oxadiazol-3-yl)propyl]urea.
| Compound Name | 1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-[1-(5-methyl-1,2,4-oxadiazol-3-yl)propyl]urea |
|---|---|
| PubChem CID | 71856846 |
| Molecular Formula | C15H23N7O2 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-[1-(5-methyl-1,2,4-oxadiazol-3-yl)propyl]urea |
| SMILES | CCc1nc2n(n1)CCCC2NC(=O)NC(CC)c1noc(C)n1 |
| InChI | InChI=1S/C15H23N7O2/c1-4-10(13-16-9(3)24-21-13)17-15(23)18-11-7-6-8-22-14(11)19-12(5-2)20-22/h10-11H,4-8H2,1-3H3,(H2,17,18,23) |
| InChIKey | PVTLWHRLNVLRSQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 110.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |