C20H19N3O2 — CID 71858389
imidazo[1,2-a]pyridin-3-ylmethyl 4-(1H-indol-3-yl)butanoate (PubChem CID 71858389) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is imidazo[1,2-a]pyridin-3-ylmethyl 4-(1H-indol-3-yl)butanoate.
| Compound Name | imidazo[1,2-a]pyridin-3-ylmethyl 4-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 71858389 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | imidazo[1,2-a]pyridin-3-ylmethyl 4-(1H-indol-3-yl)butanoate |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)OCc1cnc2ccccn12 |
| InChI | InChI=1S/C20H19N3O2/c24-20(25-14-16-13-22-19-9-3-4-11-23(16)19)10-5-6-15-12-21-18-8-2-1-7-17(15)18/h1-4,7-9,11-13,21H,5-6,10,14H2 |
| InChIKey | ASBRQFFFMRFANJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |