C22H22N4O2S2 — CID 71907117
4-(1,3-benzothiazol-2-ylsulfanyl)-N-[1-(3-phenyl-1,2,4-oxadiazol-5-yl)propan-2-yl]butanamide (PubChem CID 71907117) has the molecular formula C22H22N4O2S2 and a molecular weight of 438.58 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[1-(3-phenyl-1,2,4-oxadiazol-5-yl)propan-2-yl]butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[1-(3-phenyl-1,2,4-oxadiazol-5-yl)propan-2-yl]butanamide |
|---|---|
| PubChem CID | 71907117 |
| Molecular Formula | C22H22N4O2S2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[1-(3-phenyl-1,2,4-oxadiazol-5-yl)propan-2-yl]butanamide |
| SMILES | CC(Cc1nc(-c2ccccc2)no1)NC(=O)CCCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C22H22N4O2S2/c1-15(14-20-25-21(26-28-20)16-8-3-2-4-9-16)23-19(27)12-7-13-29-22-24-17-10-5-6-11-18(17)30-22/h2-6,8-11,15H,7,12-14H2,1H3,(H,23,27) |
| InChIKey | BAHMWNMOKJZLSA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|