C12H18N2OS — CID 71936788
azocan-1-yl-(2-methyl-1,3-thiazol-4-yl)methanone (PubChem CID 71936788) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is azocan-1-yl-(2-methyl-1,3-thiazol-4-yl)methanone.
| Compound Name | azocan-1-yl-(2-methyl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 71936788 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | azocan-1-yl-(2-methyl-1,3-thiazol-4-yl)methanone |
| SMILES | Cc1nc(C(=O)N2CCCCCCC2)cs1 |
| InChI | InChI=1S/C12H18N2OS/c1-10-13-11(9-16-10)12(15)14-7-5-3-2-4-6-8-14/h9H,2-8H2,1H3 |
| InChIKey | JFFHXLFNOSASRT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |