C27H33NO6 — CID 71963767
6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-N-[2-(2-methoxyphenyl)ethyl]-4-methylhex-4-enamide (PubChem CID 71963767) has the molecular formula C27H33NO6 and a molecular weight of 467.56 g/mol. Its IUPAC name is 6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-N-[2-(2-methoxyphenyl)ethyl]-4-methylhex-4-enamide.
| Compound Name | 6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-N-[2-(2-methoxyphenyl)ethyl]-4-methylhex-4-enamide |
|---|---|
| PubChem CID | 71963767 |
| Molecular Formula | C27H33NO6 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-N-[2-(2-methoxyphenyl)ethyl]-4-methylhex-4-enamide |
| SMILES | COc1ccccc1CCNC(=O)CCC(C)=CCc1c(OC)c(C)c2c(c1OC)C(=O)OC2 |
| InChI | InChI=1S/C27H33NO6/c1-17(11-13-23(29)28-15-14-19-8-6-7-9-22(19)31-3)10-12-20-25(32-4)18(2)21-16-34-27(30)24(21)26(20)33-5/h6-10H,11-16H2,1-5H3,(H,28,29) |
| InChIKey | SYGZIMCVTMNLQZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|