C19H33N3O2 — CID 71994812
N-[2-[4-(3,4,4-trimethylpent-2-enoyl)piperazin-1-yl]ethyl]cyclobutanecarboxamide (PubChem CID 71994812) has the molecular formula C19H33N3O2 and a molecular weight of 335.49 g/mol. Its IUPAC name is N-[2-[4-(3,4,4-trimethylpent-2-enoyl)piperazin-1-yl]ethyl]cyclobutanecarboxamide.
| Compound Name | N-[2-[4-(3,4,4-trimethylpent-2-enoyl)piperazin-1-yl]ethyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 71994812 |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | N-[2-[4-(3,4,4-trimethylpent-2-enoyl)piperazin-1-yl]ethyl]cyclobutanecarboxamide |
| SMILES | CC(=CC(=O)N1CCN(CCNC(=O)C2CCC2)CC1)C(C)(C)C |
| InChI | InChI=1S/C19H33N3O2/c1-15(19(2,3)4)14-17(23)22-12-10-21(11-13-22)9-8-20-18(24)16-6-5-7-16/h14,16H,5-13H2,1-4H3,(H,20,24) |
| InChIKey | DHAWURVCPCVTJV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|