C12H17F2NO3S — CID 71996836
N-[[2-(difluoromethoxy)phenyl]methyl]-N-methylpropane-1-sulfonamide (PubChem CID 71996836) has the molecular formula C12H17F2NO3S and a molecular weight of 293.33 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]methyl]-N-methylpropane-1-sulfonamide.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]methyl]-N-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 71996836 |
| Molecular Formula | C12H17F2NO3S |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]methyl]-N-methylpropane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)N(C)Cc1ccccc1OC(F)F |
| InChI | InChI=1S/C12H17F2NO3S/c1-3-8-19(16,17)15(2)9-10-6-4-5-7-11(10)18-12(13)14/h4-7,12H,3,8-9H2,1-2H3 |
| InChIKey | IXDXVEOPZOKGKU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |